C21H32F3O3P — CID 118447376
1-[(3R,5R,8R,9R,10S,13S,14S,17S)-3-hydroxy-13-methyl-3-(trifluoromethyl)-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-phosphanyloxyethanone (PubChem CID 118447376) has the molecular formula C21H32F3O3P and a molecular weight of 420.45 g/mol. Its IUPAC name is 1-[(3R,5R,8R,9R,10S,13S,14S,17S)-3-hydroxy-13-methyl-3-(trifluoromethyl)-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-phosphanyloxyethanone.
| Compound Name | 1-[(3R,5R,8R,9R,10S,13S,14S,17S)-3-hydroxy-13-methyl-3-(trifluoromethyl)-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-phosphanyloxyethanone |
|---|---|
| PubChem CID | 118447376 |
| Molecular Formula | C21H32F3O3P |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 1-[(3R,5R,8R,9R,10S,13S,14S,17S)-3-hydroxy-13-methyl-3-(trifluoromethyl)-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-phosphanyloxyethanone |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@@](O)(C(F)(F)F)CC[C@@H]43)[C@@H]1CC[C@@H]2C(=O)COP |
| InChI | InChI=1S/C21H32F3O3P/c1-19-8-6-14-13-7-9-20(26,21(22,23)24)10-12(13)2-3-15(14)16(19)4-5-17(19)18(25)11-27-28/h12-17,26H,2-11,28H2,1H3/t12-,13+,14-,15-,16+,17-,19+,20-/m1/s1 |
| InChIKey | SVCZUJOXQVCWRV-UDIGXYHRSA-N |
| XLogP | 4.92 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|