C21H30F3Na2O6P — CID 70086319
disodium;[2-[(5R,10S,13S,17S)-3-hydroxy-13-methyl-3-(trifluoromethyl)-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] phosphate (PubChem CID 70086319) has the molecular formula C21H30F3Na2O6P and a molecular weight of 512.41 g/mol. Its IUPAC name is disodium;[2-[(5R,10S,13S,17S)-3-hydroxy-13-methyl-3-(trifluoromethyl)-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] phosphate.
| Compound Name | disodium;[2-[(5R,10S,13S,17S)-3-hydroxy-13-methyl-3-(trifluoromethyl)-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] phosphate |
|---|---|
| PubChem CID | 70086319 |
| Molecular Formula | C21H30F3Na2O6P |
| Molecular Weight | 512.41 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | disodium;[2-[(5R,10S,13S,17S)-3-hydroxy-13-methyl-3-(trifluoromethyl)-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] phosphate |
| SMILES | C[C@]12CCC3C(CC[C@@H]4CC(O)(C(F)(F)F)CC[C@H]34)C1CC[C@@H]2C(=O)COP(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C21H32F3O6P.2Na/c1-19-8-6-14-13-7-9-20(26,21(22,23)24)10-12(13)2-3-15(14)16(19)4-5-17(19)18(25)11-30-31(27,28)29;;/h12-17,26H,2-11H2,1H3,(H2,27,28,29);;/q;2*+1/p-2/t12-,13+,14?,15?,16?,17-,19+,20?;;/m1../s1 |
| InChIKey | QDADDDMZDGAOKS-ASOXDJJYSA-L |
| XLogP | -3.03 |
| TPSA | 109.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.41 |
| LogP ≤ 5 | -3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|