C21H32F3IO2 — CID 162591888
2-methoxy-1-[(2R,10R,11S,14S,15S)-15-methyl-5-(trifluoromethyl)-5λ3-iodatetracyclo[8.7.0.02,7.011,15]heptadecan-14-yl]ethanone (PubChem CID 162591888) has the molecular formula C21H32F3IO2 and a molecular weight of 500.38 g/mol. Its IUPAC name is 2-methoxy-1-[(2R,10R,11S,14S,15S)-15-methyl-5-(trifluoromethyl)-5λ3-iodatetracyclo[8.7.0.02,7.011,15]heptadecan-14-yl]ethanone.
| Compound Name | 2-methoxy-1-[(2R,10R,11S,14S,15S)-15-methyl-5-(trifluoromethyl)-5λ3-iodatetracyclo[8.7.0.02,7.011,15]heptadecan-14-yl]ethanone |
|---|---|
| PubChem CID | 162591888 |
| Molecular Formula | C21H32F3IO2 |
| Molecular Weight | 500.38 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | 2-methoxy-1-[(2R,10R,11S,14S,15S)-15-methyl-5-(trifluoromethyl)-5λ3-iodatetracyclo[8.7.0.02,7.011,15]heptadecan-14-yl]ethanone |
| SMILES | COCC(=O)[C@H]1CC[C@H]2[C@@H]3CCC4CI(C(F)(F)F)CC[C@@H]4C3CC[C@]12C |
| InChI | InChI=1S/C21H32F3IO2/c1-20-9-7-15-14-8-10-25(21(22,23)24)11-13(14)3-4-16(15)17(20)5-6-18(20)19(26)12-27-2/h13-18H,3-12H2,1-2H3/t13?,14-,15?,16+,17-,18+,20-/m0/s1 |
| InChIKey | UMMSYIVGGJRPNR-XHSFSHLZSA-N |
| XLogP | 5.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.38 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|