C39H25BrN4 — CID 118448602
6-bromo-9-(4,6-diphenyl-1,3,5-triazin-2-yl)-1,3-diphenylcarbazole (PubChem CID 118448602) has the molecular formula C39H25BrN4 and a molecular weight of 629.56 g/mol. Its IUPAC name is 6-bromo-9-(4,6-diphenyl-1,3,5-triazin-2-yl)-1,3-diphenylcarbazole.
| Compound Name | 6-bromo-9-(4,6-diphenyl-1,3,5-triazin-2-yl)-1,3-diphenylcarbazole |
|---|---|
| PubChem CID | 118448602 |
| Molecular Formula | C39H25BrN4 |
| Molecular Weight | 629.56 g/mol |
| Exact Mass | 628.13 |
| IUPAC Name | 6-bromo-9-(4,6-diphenyl-1,3,5-triazin-2-yl)-1,3-diphenylcarbazole |
| SMILES | Brc1ccc2c(c1)c1cc(-c3ccccc3)cc(-c3ccccc3)c1n2-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C39H25BrN4/c40-31-21-22-35-33(25-31)34-24-30(26-13-5-1-6-14-26)23-32(27-15-7-2-8-16-27)36(34)44(35)39-42-37(28-17-9-3-10-18-28)41-38(43-39)29-19-11-4-12-20-29/h1-25H |
| InChIKey | YFZAHWCXBVBQSX-UHFFFAOYSA-N |
| XLogP | 10.40 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.56 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |