C43H31N7 — CID 118448619
3-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-[4-(3-methylcyclohexa-1,5-dien-1-yl)-6-phenyl-1,3,5-triazin-2-yl]-9H-carbazole (PubChem CID 118448619) has the molecular formula C43H31N7 and a molecular weight of 645.77 g/mol. Its IUPAC name is 3-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-[4-(3-methylcyclohexa-1,5-dien-1-yl)-6-phenyl-1,3,5-triazin-2-yl]-9H-carbazole.
| Compound Name | 3-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-[4-(3-methylcyclohexa-1,5-dien-1-yl)-6-phenyl-1,3,5-triazin-2-yl]-9H-carbazole |
|---|---|
| PubChem CID | 118448619 |
| Molecular Formula | C43H31N7 |
| Molecular Weight | 645.77 g/mol |
| Exact Mass | 645.26 |
| IUPAC Name | 3-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-[4-(3-methylcyclohexa-1,5-dien-1-yl)-6-phenyl-1,3,5-triazin-2-yl]-9H-carbazole |
| SMILES | CC1C=C(c2nc(-c3ccccc3)nc(-c3cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc4c3[nH]c3ccccc34)n2)C=CC1 |
| InChI | InChI=1S/C43H31N7/c1-27-14-13-21-31(24-27)41-46-40(30-19-9-4-10-20-30)49-43(50-41)35-26-32(25-34-33-22-11-12-23-36(33)44-37(34)35)42-47-38(28-15-5-2-6-16-28)45-39(48-42)29-17-7-3-8-18-29/h2-13,15-27,44H,14H2,1H3 |
| InChIKey | ICYVRKKLULGDKU-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 93.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.77 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |