C49H34N8 — CID 166695966
11-(4,6-diphenyl-1,3,5-triazin-2-yl)-12-[4-(3-methylcyclohexa-1,5-dien-1-yl)-6-phenyl-1,3,5-triazin-2-yl]indolo[2,3-a]carbazole (PubChem CID 166695966) has the molecular formula C49H34N8 and a molecular weight of 734.87 g/mol. Its IUPAC name is 11-(4,6-diphenyl-1,3,5-triazin-2-yl)-12-[4-(3-methylcyclohexa-1,5-dien-1-yl)-6-phenyl-1,3,5-triazin-2-yl]indolo[2,3-a]carbazole.
| Compound Name | 11-(4,6-diphenyl-1,3,5-triazin-2-yl)-12-[4-(3-methylcyclohexa-1,5-dien-1-yl)-6-phenyl-1,3,5-triazin-2-yl]indolo[2,3-a]carbazole |
|---|---|
| PubChem CID | 166695966 |
| Molecular Formula | C49H34N8 |
| Molecular Weight | 734.87 g/mol |
| Exact Mass | 734.29 |
| IUPAC Name | 11-(4,6-diphenyl-1,3,5-triazin-2-yl)-12-[4-(3-methylcyclohexa-1,5-dien-1-yl)-6-phenyl-1,3,5-triazin-2-yl]indolo[2,3-a]carbazole |
| SMILES | CC1C=C(c2nc(-c3ccccc3)nc(-n3c4ccccc4c4ccc5c6ccccc6n(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)c5c43)n2)C=CC1 |
| InChI | InChI=1S/C49H34N8/c1-31-16-15-23-35(30-31)47-51-46(34-21-9-4-10-22-34)54-49(55-47)57-41-27-14-12-25-37(41)39-29-28-38-36-24-11-13-26-40(36)56(42(38)43(39)57)48-52-44(32-17-5-2-6-18-32)50-45(53-48)33-19-7-3-8-20-33/h2-15,17-31H,16H2,1H3 |
| InChIKey | HIPKEHMDIYGBPX-UHFFFAOYSA-N |
| XLogP | 11.23 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.87 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |