C9H13N3 — CID 118449685
1,4,7-triazatricyclo[7.3.0.03,7]dodeca-9,11-diene (PubChem CID 118449685) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 1,4,7-triazatricyclo[7.3.0.03,7]dodeca-9,11-diene.
| Compound Name | 1,4,7-triazatricyclo[7.3.0.03,7]dodeca-9,11-diene |
|---|---|
| PubChem CID | 118449685 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 1,4,7-triazatricyclo[7.3.0.03,7]dodeca-9,11-diene |
| SMILES | c1cc2n(c1)CC1NCCN1C2 |
| InChI | InChI=1S/C9H13N3/c1-2-8-6-12-5-3-10-9(12)7-11(8)4-1/h1-2,4,9-10H,3,5-7H2 |
| InChIKey | VZAZBHHNEMCICP-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |