C10H16N2 — CID 174246085
2-methyl-1,2,3,4,5,6-hexahydropyrrolo[1,2-d][1,4]diazocine (PubChem CID 174246085) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 2-methyl-1,2,3,4,5,6-hexahydropyrrolo[1,2-d][1,4]diazocine.
| Compound Name | 2-methyl-1,2,3,4,5,6-hexahydropyrrolo[1,2-d][1,4]diazocine |
|---|---|
| PubChem CID | 174246085 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 2-methyl-1,2,3,4,5,6-hexahydropyrrolo[1,2-d][1,4]diazocine |
| SMILES | CC1Cn2cccc2CCCN1 |
| InChI | InChI=1S/C10H16N2/c1-9-8-12-7-3-5-10(12)4-2-6-11-9/h3,5,7,9,11H,2,4,6,8H2,1H3 |
| InChIKey | QCBYUDVZHCDMEX-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |