C25H28N6O3S — CID 118453118
N-[7-(methylamino)-1-[5-[4-(1-methylpyrazol-3-yl)phenyl]-1,3-oxazol-2-yl]-7-oxoheptyl]-1,2-thiazole-4-carboxamide (PubChem CID 118453118) has the molecular formula C25H28N6O3S and a molecular weight of 492.61 g/mol. Its IUPAC name is N-[7-(methylamino)-1-[5-[4-(1-methylpyrazol-3-yl)phenyl]-1,3-oxazol-2-yl]-7-oxoheptyl]-1,2-thiazole-4-carboxamide.
| Compound Name | N-[7-(methylamino)-1-[5-[4-(1-methylpyrazol-3-yl)phenyl]-1,3-oxazol-2-yl]-7-oxoheptyl]-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 118453118 |
| Molecular Formula | C25H28N6O3S |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | N-[7-(methylamino)-1-[5-[4-(1-methylpyrazol-3-yl)phenyl]-1,3-oxazol-2-yl]-7-oxoheptyl]-1,2-thiazole-4-carboxamide |
| SMILES | CNC(=O)CCCCCC(NC(=O)c1cnsc1)c1ncc(-c2ccc(-c3ccn(C)n3)cc2)o1 |
| InChI | InChI=1S/C25H28N6O3S/c1-26-23(32)7-5-3-4-6-21(29-24(33)19-14-28-35-16-19)25-27-15-22(34-25)18-10-8-17(9-11-18)20-12-13-31(2)30-20/h8-16,21H,3-7H2,1-2H3,(H,26,32)(H,29,33) |
| InChIKey | SGWDPCDHEOFLCQ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 114.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|