C26H28N6O2S — CID 118453227
N-[7-(methylamino)-7-oxo-1-[5-(4-pyridin-4-ylphenyl)-1H-imidazol-2-yl]heptyl]-1,3-thiazole-5-carboxamide (PubChem CID 118453227) has the molecular formula C26H28N6O2S and a molecular weight of 488.62 g/mol. Its IUPAC name is N-[7-(methylamino)-7-oxo-1-[5-(4-pyridin-4-ylphenyl)-1H-imidazol-2-yl]heptyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[7-(methylamino)-7-oxo-1-[5-(4-pyridin-4-ylphenyl)-1H-imidazol-2-yl]heptyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 118453227 |
| Molecular Formula | C26H28N6O2S |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | N-[7-(methylamino)-7-oxo-1-[5-(4-pyridin-4-ylphenyl)-1H-imidazol-2-yl]heptyl]-1,3-thiazole-5-carboxamide |
| SMILES | CNC(=O)CCCCCC(NC(=O)c1cncs1)c1ncc(-c2ccc(-c3ccncc3)cc2)[nH]1 |
| InChI | InChI=1S/C26H28N6O2S/c1-27-24(33)6-4-2-3-5-21(32-26(34)23-16-29-17-35-23)25-30-15-22(31-25)20-9-7-18(8-10-20)19-11-13-28-14-12-19/h7-17,21H,2-6H2,1H3,(H,27,33)(H,30,31)(H,32,34) |
| InChIKey | MXQAYKVURWJOPC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|