C26H29N7O2S — CID 123906303
N-[8-(methylamino)-2-[5-[4-(1-methylpyrazol-4-yl)phenyl]-1H-imidazol-2-yl]-8-oxooctylidene]-1,3-thiazole-5-carboxamide (PubChem CID 123906303) has the molecular formula C26H29N7O2S and a molecular weight of 503.63 g/mol. Its IUPAC name is N-[8-(methylamino)-2-[5-[4-(1-methylpyrazol-4-yl)phenyl]-1H-imidazol-2-yl]-8-oxooctylidene]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[8-(methylamino)-2-[5-[4-(1-methylpyrazol-4-yl)phenyl]-1H-imidazol-2-yl]-8-oxooctylidene]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 123906303 |
| Molecular Formula | C26H29N7O2S |
| Molecular Weight | 503.63 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | N-[8-(methylamino)-2-[5-[4-(1-methylpyrazol-4-yl)phenyl]-1H-imidazol-2-yl]-8-oxooctylidene]-1,3-thiazole-5-carboxamide |
| SMILES | CNC(=O)CCCCCC(/C=N/C(=O)c1cncs1)c1ncc(-c2ccc(-c3cnn(C)c3)cc2)[nH]1 |
| InChI | InChI=1S/C26H29N7O2S/c1-27-24(34)7-5-3-4-6-20(12-30-26(35)23-15-28-17-36-23)25-29-14-22(32-25)19-10-8-18(9-11-19)21-13-31-33(2)16-21/h8-17,20H,3-7H2,1-2H3,(H,27,34)(H,29,32)/b30-12+ |
| InChIKey | NSMGWGIJWHLOFS-PNQUVVCRSA-N |
| XLogP | 4.62 |
| TPSA | 117.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.63 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|