C27H31N5O3S — CID 123299959
N-[2-[5-(6-methoxynaphthalen-2-yl)-1H-imidazol-2-yl]-8-(methylamino)-8-oxooctyl]-1,3-thiazole-5-carboxamide (PubChem CID 123299959) has the molecular formula C27H31N5O3S and a molecular weight of 505.64 g/mol. Its IUPAC name is N-[2-[5-(6-methoxynaphthalen-2-yl)-1H-imidazol-2-yl]-8-(methylamino)-8-oxooctyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[2-[5-(6-methoxynaphthalen-2-yl)-1H-imidazol-2-yl]-8-(methylamino)-8-oxooctyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 123299959 |
| Molecular Formula | C27H31N5O3S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | N-[2-[5-(6-methoxynaphthalen-2-yl)-1H-imidazol-2-yl]-8-(methylamino)-8-oxooctyl]-1,3-thiazole-5-carboxamide |
| SMILES | CNC(=O)CCCCCC(CNC(=O)c1cncs1)c1ncc(-c2ccc3cc(OC)ccc3c2)[nH]1 |
| InChI | InChI=1S/C27H31N5O3S/c1-28-25(33)7-5-3-4-6-21(14-31-27(34)24-16-29-17-36-24)26-30-15-23(32-26)20-9-8-19-13-22(35-2)11-10-18(19)12-20/h8-13,15-17,21H,3-7,14H2,1-2H3,(H,28,33)(H,30,32)(H,31,34) |
| InChIKey | UDRXOOLUOXWTDU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|