C31H29FN4O3S — CID 164973267
N-[(1S)-7-(2-fluoro-6-methoxyphenyl)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxoheptyl]-1,3-thiazole-5-carboxamide (PubChem CID 164973267) has the molecular formula C31H29FN4O3S and a molecular weight of 556.66 g/mol. Its IUPAC name is N-[(1S)-7-(2-fluoro-6-methoxyphenyl)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxoheptyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(1S)-7-(2-fluoro-6-methoxyphenyl)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxoheptyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 164973267 |
| Molecular Formula | C31H29FN4O3S |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | N-[(1S)-7-(2-fluoro-6-methoxyphenyl)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxoheptyl]-1,3-thiazole-5-carboxamide |
| SMILES | COc1cccc(F)c1C(=O)CCCCC[C@H](NC(=O)c1cncs1)c1ncc(-c2ccc3ccccc3c2)[nH]1 |
| InChI | InChI=1S/C31H29FN4O3S/c1-39-27-13-7-10-23(32)29(27)26(37)12-4-2-3-11-24(36-31(38)28-18-33-19-40-28)30-34-17-25(35-30)22-15-14-20-8-5-6-9-21(20)16-22/h5-10,13-19,24H,2-4,11-12H2,1H3,(H,34,35)(H,36,38)/t24-/m0/s1 |
| InChIKey | OIMHKVJDULTURS-DEOSSOPVSA-N |
| XLogP | 7.14 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|