C30H26F3N5O3S — CID 155705130
N-[1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-5-[[2-(trifluoromethoxy)benzoyl]amino]pentyl]-1,3-thiazole-5-carboxamide (PubChem CID 155705130) has the molecular formula C30H26F3N5O3S and a molecular weight of 593.63 g/mol. Its IUPAC name is N-[1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-5-[[2-(trifluoromethoxy)benzoyl]amino]pentyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-5-[[2-(trifluoromethoxy)benzoyl]amino]pentyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 155705130 |
| Molecular Formula | C30H26F3N5O3S |
| Molecular Weight | 593.63 g/mol |
| Exact Mass | 593.17 |
| IUPAC Name | N-[1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-5-[[2-(trifluoromethoxy)benzoyl]amino]pentyl]-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NC(CCCCNC(=O)c1ccccc1OC(F)(F)F)c1ncc(-c2ccc3ccccc3c2)[nH]1)c1cncs1 |
| InChI | InChI=1S/C30H26F3N5O3S/c31-30(32,33)41-25-11-4-3-9-22(25)28(39)35-14-6-5-10-23(38-29(40)26-17-34-18-42-26)27-36-16-24(37-27)21-13-12-19-7-1-2-8-20(19)15-21/h1-4,7-9,11-13,15-18,23H,5-6,10,14H2,(H,35,39)(H,36,37)(H,38,40) |
| InChIKey | XOSRMYNAUMUONH-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.63 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|