C30H30N6O2S — CID 155169292
N-[5-[[2-(methylamino)benzoyl]amino]-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)pentyl]-1,3-thiazole-5-carboxamide (PubChem CID 155169292) has the molecular formula C30H30N6O2S and a molecular weight of 538.68 g/mol. Its IUPAC name is N-[5-[[2-(methylamino)benzoyl]amino]-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)pentyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[5-[[2-(methylamino)benzoyl]amino]-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)pentyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 155169292 |
| Molecular Formula | C30H30N6O2S |
| Molecular Weight | 538.68 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | N-[5-[[2-(methylamino)benzoyl]amino]-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)pentyl]-1,3-thiazole-5-carboxamide |
| SMILES | CNc1ccccc1C(=O)NCCCCC(NC(=O)c1cncs1)c1ncc(-c2ccc3ccccc3c2)[nH]1 |
| InChI | InChI=1S/C30H30N6O2S/c1-31-24-11-5-4-10-23(24)29(37)33-15-7-6-12-25(36-30(38)27-18-32-19-39-27)28-34-17-26(35-28)22-14-13-20-8-2-3-9-21(20)16-22/h2-5,8-11,13-14,16-19,25,31H,6-7,12,15H2,1H3,(H,33,37)(H,34,35)(H,36,38) |
| InChIKey | DMLMKQIHOFYZPV-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.68 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|