C26H28N4O — CID 155172384
2-(methylamino)-N-[5-(5-naphthalen-2-yl-1H-imidazol-2-yl)pentyl]benzamide (PubChem CID 155172384) has the molecular formula C26H28N4O and a molecular weight of 412.54 g/mol. Its IUPAC name is 2-(methylamino)-N-[5-(5-naphthalen-2-yl-1H-imidazol-2-yl)pentyl]benzamide.
| Compound Name | 2-(methylamino)-N-[5-(5-naphthalen-2-yl-1H-imidazol-2-yl)pentyl]benzamide |
|---|---|
| PubChem CID | 155172384 |
| Molecular Formula | C26H28N4O |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 2-(methylamino)-N-[5-(5-naphthalen-2-yl-1H-imidazol-2-yl)pentyl]benzamide |
| SMILES | CNc1ccccc1C(=O)NCCCCCc1ncc(-c2ccc3ccccc3c2)[nH]1 |
| InChI | InChI=1S/C26H28N4O/c1-27-23-12-7-6-11-22(23)26(31)28-16-8-2-3-13-25-29-18-24(30-25)21-15-14-19-9-4-5-10-20(19)17-21/h4-7,9-12,14-15,17-18,27H,2-3,8,13,16H2,1H3,(H,28,31)(H,29,30) |
| InChIKey | FQFYNTYIMNVSSB-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|