C30H29N5O3S2 — CID 162657535
N-[(1S)-5-[(2-methylsulfinylbenzoyl)amino]-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)pentyl]-1,3-thiazole-5-carboxamide (PubChem CID 162657535) has the molecular formula C30H29N5O3S2 and a molecular weight of 571.73 g/mol. Its IUPAC name is N-[(1S)-5-[(2-methylsulfinylbenzoyl)amino]-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)pentyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(1S)-5-[(2-methylsulfinylbenzoyl)amino]-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)pentyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 162657535 |
| Molecular Formula | C30H29N5O3S2 |
| Molecular Weight | 571.73 g/mol |
| Exact Mass | 571.17 |
| IUPAC Name | N-[(1S)-5-[(2-methylsulfinylbenzoyl)amino]-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)pentyl]-1,3-thiazole-5-carboxamide |
| SMILES | CS(=O)c1ccccc1C(=O)NCCCC[C@H](NC(=O)c1cncs1)c1ncc(-c2ccc3ccccc3c2)[nH]1 |
| InChI | InChI=1S/C30H29N5O3S2/c1-40(38)27-12-5-4-10-23(27)29(36)32-15-7-6-11-24(35-30(37)26-18-31-19-39-26)28-33-17-25(34-28)22-14-13-20-8-2-3-9-21(20)16-22/h2-5,8-10,12-14,16-19,24H,6-7,11,15H2,1H3,(H,32,36)(H,33,34)(H,35,37)/t24-,40?/m0/s1 |
| InChIKey | JTNKTSPKIQWYKH-NKKYMYNVSA-N |
| XLogP | 5.50 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.73 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|