C31H30FN5O2S — CID 164995957
N-[(1S)-7-(2-amino-5-fluoro-3-methylphenyl)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxoheptyl]-1,3-thiazole-5-carboxamide (PubChem CID 164995957) has the molecular formula C31H30FN5O2S and a molecular weight of 555.68 g/mol. Its IUPAC name is N-[(1S)-7-(2-amino-5-fluoro-3-methylphenyl)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxoheptyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(1S)-7-(2-amino-5-fluoro-3-methylphenyl)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxoheptyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 164995957 |
| Molecular Formula | C31H30FN5O2S |
| Molecular Weight | 555.68 g/mol |
| Exact Mass | 555.21 |
| IUPAC Name | N-[(1S)-7-(2-amino-5-fluoro-3-methylphenyl)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxoheptyl]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1cc(F)cc(C(=O)CCCCC[C@H](NC(=O)c2cncs2)c2ncc(-c3ccc4ccccc4c3)[nH]2)c1N |
| InChI | InChI=1S/C31H30FN5O2S/c1-19-13-23(32)15-24(29(19)33)27(38)10-4-2-3-9-25(37-31(39)28-17-34-18-40-28)30-35-16-26(36-30)22-12-11-20-7-5-6-8-21(20)14-22/h5-8,11-18,25H,2-4,9-10,33H2,1H3,(H,35,36)(H,37,39)/t25-/m0/s1 |
| InChIKey | DTLVYKQCJDPDFL-VWLOTQADSA-N |
| XLogP | 7.02 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.68 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|