C30H27ClN4O2S — CID 164988102
N-[(1S)-7-(2-chlorophenyl)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxoheptyl]-1,3-thiazole-5-carboxamide (PubChem CID 164988102) has the molecular formula C30H27ClN4O2S and a molecular weight of 543.09 g/mol. Its IUPAC name is N-[(1S)-7-(2-chlorophenyl)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxoheptyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(1S)-7-(2-chlorophenyl)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxoheptyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 164988102 |
| Molecular Formula | C30H27ClN4O2S |
| Molecular Weight | 543.09 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | N-[(1S)-7-(2-chlorophenyl)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxoheptyl]-1,3-thiazole-5-carboxamide |
| SMILES | O=C(N[C@@H](CCCCCC(=O)c1ccccc1Cl)c1ncc(-c2ccc3ccccc3c2)[nH]1)c1cncs1 |
| InChI | InChI=1S/C30H27ClN4O2S/c31-24-11-7-6-10-23(24)27(36)13-3-1-2-12-25(35-30(37)28-18-32-19-38-28)29-33-17-26(34-29)22-15-14-20-8-4-5-9-21(20)16-22/h4-11,14-19,25H,1-3,12-13H2,(H,33,34)(H,35,37)/t25-/m0/s1 |
| InChIKey | XHSPFCHKWSAANK-VWLOTQADSA-N |
| XLogP | 7.64 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.09 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|