C30H27FN4O2S2 — CID 164973265
N-[(1S)-7-(5-fluoro-2-sulfanylphenyl)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxoheptyl]-1,3-thiazole-5-carboxamide (PubChem CID 164973265) has the molecular formula C30H27FN4O2S2 and a molecular weight of 558.70 g/mol. Its IUPAC name is N-[(1S)-7-(5-fluoro-2-sulfanylphenyl)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxoheptyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(1S)-7-(5-fluoro-2-sulfanylphenyl)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxoheptyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 164973265 |
| Molecular Formula | C30H27FN4O2S2 |
| Molecular Weight | 558.70 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | N-[(1S)-7-(5-fluoro-2-sulfanylphenyl)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxoheptyl]-1,3-thiazole-5-carboxamide |
| SMILES | O=C(N[C@@H](CCCCCC(=O)c1cc(F)ccc1S)c1ncc(-c2ccc3ccccc3c2)[nH]1)c1cncs1 |
| InChI | InChI=1S/C30H27FN4O2S2/c31-22-12-13-27(38)23(15-22)26(36)9-3-1-2-8-24(35-30(37)28-17-32-18-39-28)29-33-16-25(34-29)21-11-10-19-6-4-5-7-20(19)14-21/h4-7,10-18,24,38H,1-3,8-9H2,(H,33,34)(H,35,37)/t24-/m0/s1 |
| InChIKey | LCVWHSOZQLXUJN-DEOSSOPVSA-N |
| XLogP | 7.42 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.70 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|