C24H26N6O3S — CID 144617633
N-[7-amino-1-[5-(3-methoxyisoquinolin-7-yl)-1H-imidazol-2-yl]-7-oxoheptyl]-1,3-thiazole-5-carboxamide (PubChem CID 144617633) has the molecular formula C24H26N6O3S and a molecular weight of 478.58 g/mol. Its IUPAC name is N-[7-amino-1-[5-(3-methoxyisoquinolin-7-yl)-1H-imidazol-2-yl]-7-oxoheptyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[7-amino-1-[5-(3-methoxyisoquinolin-7-yl)-1H-imidazol-2-yl]-7-oxoheptyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 144617633 |
| Molecular Formula | C24H26N6O3S |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | N-[7-amino-1-[5-(3-methoxyisoquinolin-7-yl)-1H-imidazol-2-yl]-7-oxoheptyl]-1,3-thiazole-5-carboxamide |
| SMILES | COc1cc2ccc(-c3cnc(C(CCCCCC(N)=O)NC(=O)c4cncs4)[nH]3)cc2cn1 |
| InChI | InChI=1S/C24H26N6O3S/c1-33-22-10-15-7-8-16(9-17(15)11-27-22)19-12-28-23(29-19)18(5-3-2-4-6-21(25)31)30-24(32)20-13-26-14-34-20/h7-14,18H,2-6H2,1H3,(H2,25,31)(H,28,29)(H,30,32) |
| InChIKey | UIJXABZMGXTOEP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 135.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|