C24H27N7O2S — CID 74221664
N-[(1S)-7-(methylamino)-7-oxo-1-[5-[4-(1H-pyrazol-5-yl)phenyl]-1H-imidazol-2-yl]heptyl]-1,3-thiazole-5-carboxamide (PubChem CID 74221664) has the molecular formula C24H27N7O2S and a molecular weight of 477.59 g/mol. Its IUPAC name is N-[(1S)-7-(methylamino)-7-oxo-1-[5-[4-(1H-pyrazol-5-yl)phenyl]-1H-imidazol-2-yl]heptyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(1S)-7-(methylamino)-7-oxo-1-[5-[4-(1H-pyrazol-5-yl)phenyl]-1H-imidazol-2-yl]heptyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 74221664 |
| Molecular Formula | C24H27N7O2S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | N-[(1S)-7-(methylamino)-7-oxo-1-[5-[4-(1H-pyrazol-5-yl)phenyl]-1H-imidazol-2-yl]heptyl]-1,3-thiazole-5-carboxamide |
| SMILES | CNC(=O)CCCCC[C@H](NC(=O)c1cncs1)c1ncc(-c2ccc(-c3ccn[nH]3)cc2)[nH]1 |
| InChI | InChI=1S/C24H27N7O2S/c1-25-22(32)6-4-2-3-5-19(30-24(33)21-14-26-15-34-21)23-27-13-20(29-23)17-9-7-16(8-10-17)18-11-12-28-31-18/h7-15,19H,2-6H2,1H3,(H,25,32)(H,27,29)(H,28,31)(H,30,33)/t19-/m0/s1 |
| InChIKey | UFQDUCIOZJEAJB-IBGZPJMESA-N |
| XLogP | 4.09 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|