C23H32N8O2S — CID 123951744
N-[2-[5-[3-amino-4-(2-methylhydrazinyl)phenyl]-1H-imidazol-2-yl]-8-(methylamino)-8-oxooctyl]-1,3-thiazole-5-carboxamide (PubChem CID 123951744) has the molecular formula C23H32N8O2S and a molecular weight of 484.63 g/mol. Its IUPAC name is N-[2-[5-[3-amino-4-(2-methylhydrazinyl)phenyl]-1H-imidazol-2-yl]-8-(methylamino)-8-oxooctyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[2-[5-[3-amino-4-(2-methylhydrazinyl)phenyl]-1H-imidazol-2-yl]-8-(methylamino)-8-oxooctyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 123951744 |
| Molecular Formula | C23H32N8O2S |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | N-[2-[5-[3-amino-4-(2-methylhydrazinyl)phenyl]-1H-imidazol-2-yl]-8-(methylamino)-8-oxooctyl]-1,3-thiazole-5-carboxamide |
| SMILES | CNNc1ccc(-c2cnc(C(CCCCCC(=O)NC)CNC(=O)c3cncs3)[nH]2)cc1N |
| InChI | InChI=1S/C23H32N8O2S/c1-25-21(32)7-5-3-4-6-16(11-29-23(33)20-13-27-14-34-20)22-28-12-19(30-22)15-8-9-18(31-26-2)17(24)10-15/h8-10,12-14,16,26,31H,3-7,11,24H2,1-2H3,(H,25,32)(H,28,30)(H,29,33) |
| InChIKey | VVMJZDKHSMCDQE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 149.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|