C23H30N6O2S — CID 123508481
N-[2-[5-[4-(aminomethyl)phenyl]-1H-imidazol-2-yl]-8-(methylamino)-8-oxooctyl]-1,3-thiazole-5-carboxamide (PubChem CID 123508481) has the molecular formula C23H30N6O2S and a molecular weight of 454.60 g/mol. Its IUPAC name is N-[2-[5-[4-(aminomethyl)phenyl]-1H-imidazol-2-yl]-8-(methylamino)-8-oxooctyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[2-[5-[4-(aminomethyl)phenyl]-1H-imidazol-2-yl]-8-(methylamino)-8-oxooctyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 123508481 |
| Molecular Formula | C23H30N6O2S |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | N-[2-[5-[4-(aminomethyl)phenyl]-1H-imidazol-2-yl]-8-(methylamino)-8-oxooctyl]-1,3-thiazole-5-carboxamide |
| SMILES | CNC(=O)CCCCCC(CNC(=O)c1cncs1)c1ncc(-c2ccc(CN)cc2)[nH]1 |
| InChI | InChI=1S/C23H30N6O2S/c1-25-21(30)6-4-2-3-5-18(12-28-23(31)20-14-26-15-32-20)22-27-13-19(29-22)17-9-7-16(11-24)8-10-17/h7-10,13-15,18H,2-6,11-12,24H2,1H3,(H,25,30)(H,27,29)(H,28,31) |
| InChIKey | QUHJZDHBGDDQNV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|