C33H32N4O2S — CID 164988106
N-[(1S)-7-(2,3-dihydro-1H-inden-4-yl)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxoheptyl]-1,3-thiazole-5-carboxamide (PubChem CID 164988106) has the molecular formula C33H32N4O2S and a molecular weight of 548.71 g/mol. Its IUPAC name is N-[(1S)-7-(2,3-dihydro-1H-inden-4-yl)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxoheptyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(1S)-7-(2,3-dihydro-1H-inden-4-yl)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxoheptyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 164988106 |
| Molecular Formula | C33H32N4O2S |
| Molecular Weight | 548.71 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | N-[(1S)-7-(2,3-dihydro-1H-inden-4-yl)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-7-oxoheptyl]-1,3-thiazole-5-carboxamide |
| SMILES | O=C(N[C@@H](CCCCCC(=O)c1cccc2c1CCC2)c1ncc(-c2ccc3ccccc3c2)[nH]1)c1cncs1 |
| InChI | InChI=1S/C33H32N4O2S/c38-30(27-13-7-11-23-10-6-12-26(23)27)15-3-1-2-14-28(37-33(39)31-20-34-21-40-31)32-35-19-29(36-32)25-17-16-22-8-4-5-9-24(22)18-25/h4-5,7-9,11,13,16-21,28H,1-3,6,10,12,14-15H2,(H,35,36)(H,37,39)/t28-/m0/s1 |
| InChIKey | LPEHJFAXAWJVLV-NDEPHWFRSA-N |
| XLogP | 7.48 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.71 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|