C29H37N7O2S2 — CID 155705166
5-amino-3-methyl-1,2-thiazole-4-carbaldehyde;methylamino N-[(E)-3-oxoprop-1-enyl]methanimidothioate;N-methyl-5-(5-naphthalen-2-yl-1H-imidazol-2-yl)pentan-1-amine (PubChem CID 155705166) has the molecular formula C29H37N7O2S2 and a molecular weight of 579.80 g/mol. Its IUPAC name is 5-amino-3-methyl-1,2-thiazole-4-carbaldehyde;methylamino N-[(E)-3-oxoprop-1-enyl]methanimidothioate;N-methyl-5-(5-naphthalen-2-yl-1H-imidazol-2-yl)pentan-1-amine.
| Compound Name | 5-amino-3-methyl-1,2-thiazole-4-carbaldehyde;methylamino N-[(E)-3-oxoprop-1-enyl]methanimidothioate;N-methyl-5-(5-naphthalen-2-yl-1H-imidazol-2-yl)pentan-1-amine |
|---|---|
| PubChem CID | 155705166 |
| Molecular Formula | C29H37N7O2S2 |
| Molecular Weight | 579.80 g/mol |
| Exact Mass | 579.25 |
| IUPAC Name | 5-amino-3-methyl-1,2-thiazole-4-carbaldehyde;methylamino N-[(E)-3-oxoprop-1-enyl]methanimidothioate;N-methyl-5-(5-naphthalen-2-yl-1H-imidazol-2-yl)pentan-1-amine |
| SMILES | CNCCCCCc1ncc(-c2ccc3ccccc3c2)[nH]1.CNS/C=N/C=C/C=O.Cc1nsc(N)c1C=O |
| InChI | InChI=1S/C19H23N3.C5H6N2OS.C5H8N2OS/c1-20-12-6-2-3-9-19-21-14-18(22-19)17-11-10-15-7-4-5-8-16(15)13-17;1-3-4(2-8)5(6)9-7-3;1-6-9-5-7-3-2-4-8/h4-5,7-8,10-11,13-14,20H,2-3,6,9,12H2,1H3,(H,21,22);2H,6H2,1H3;2-6H,1H3/b;;3-2+,7-5+ |
| InChIKey | QKNLQUHDZBGVIZ-BDDWAKONSA-N |
| XLogP | 5.60 |
| TPSA | 138.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.80 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|