C33H39N5O2S — CID 144617555
methanamine;N-methyl-2-(4-phenyl-1,3-thiazol-2-yl)acetamide;7-(5-naphthalen-2-yl-1H-imidazol-2-yl)heptanal (PubChem CID 144617555) has the molecular formula C33H39N5O2S and a molecular weight of 569.78 g/mol. Its IUPAC name is methanamine;N-methyl-2-(4-phenyl-1,3-thiazol-2-yl)acetamide;7-(5-naphthalen-2-yl-1H-imidazol-2-yl)heptanal.
| Compound Name | methanamine;N-methyl-2-(4-phenyl-1,3-thiazol-2-yl)acetamide;7-(5-naphthalen-2-yl-1H-imidazol-2-yl)heptanal |
|---|---|
| PubChem CID | 144617555 |
| Molecular Formula | C33H39N5O2S |
| Molecular Weight | 569.78 g/mol |
| Exact Mass | 569.28 |
| IUPAC Name | methanamine;N-methyl-2-(4-phenyl-1,3-thiazol-2-yl)acetamide;7-(5-naphthalen-2-yl-1H-imidazol-2-yl)heptanal |
| SMILES | CN.CNC(=O)Cc1nc(-c2ccccc2)cs1.O=CCCCCCCc1ncc(-c2ccc3ccccc3c2)[nH]1 |
| InChI | InChI=1S/C20H22N2O.C12H12N2OS.CH5N/c23-13-7-3-1-2-4-10-20-21-15-19(22-20)18-12-11-16-8-5-6-9-17(16)14-18;1-13-11(15)7-12-14-10(8-16-12)9-5-3-2-4-6-9;1-2/h5-6,8-9,11-15H,1-4,7,10H2,(H,21,22);2-6,8H,7H2,1H3,(H,13,15);2H2,1H3 |
| InChIKey | JQINAYWISFMHJN-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.78 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|