C24H31N7O2S — CID 144617636
methanamine;7-[5-(4-pyrazol-1-ylphenyl)-1H-imidazol-2-yl]heptanal;1,3-thiazole-5-carboxamide (PubChem CID 144617636) has the molecular formula C24H31N7O2S and a molecular weight of 481.63 g/mol. Its IUPAC name is methanamine;7-[5-(4-pyrazol-1-ylphenyl)-1H-imidazol-2-yl]heptanal;1,3-thiazole-5-carboxamide.
| Compound Name | methanamine;7-[5-(4-pyrazol-1-ylphenyl)-1H-imidazol-2-yl]heptanal;1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 144617636 |
| Molecular Formula | C24H31N7O2S |
| Molecular Weight | 481.63 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | methanamine;7-[5-(4-pyrazol-1-ylphenyl)-1H-imidazol-2-yl]heptanal;1,3-thiazole-5-carboxamide |
| SMILES | CN.NC(=O)c1cncs1.O=CCCCCCCc1ncc(-c2ccc(-n3cccn3)cc2)[nH]1 |
| InChI | InChI=1S/C19H22N4O.C4H4N2OS.CH5N/c24-14-5-3-1-2-4-7-19-20-15-18(22-19)16-8-10-17(11-9-16)23-13-6-12-21-23;5-4(7)3-1-6-2-8-3;1-2/h6,8-15H,1-5,7H2,(H,20,22);1-2H,(H2,5,7);2H2,1H3 |
| InChIKey | ZCHGWINMYKSFDA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 145.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.63 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|