C31H39N7O2S — CID 144617541
3-(1,3-benzothiazol-2-yl)-N-methylpropanamide;methanamine;7-[5-(4-pyrazol-1-ylphenyl)-1H-imidazol-2-yl]heptanal (PubChem CID 144617541) has the molecular formula C31H39N7O2S and a molecular weight of 573.77 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-N-methylpropanamide;methanamine;7-[5-(4-pyrazol-1-ylphenyl)-1H-imidazol-2-yl]heptanal.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-N-methylpropanamide;methanamine;7-[5-(4-pyrazol-1-ylphenyl)-1H-imidazol-2-yl]heptanal |
|---|---|
| PubChem CID | 144617541 |
| Molecular Formula | C31H39N7O2S |
| Molecular Weight | 573.77 g/mol |
| Exact Mass | 573.29 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-N-methylpropanamide;methanamine;7-[5-(4-pyrazol-1-ylphenyl)-1H-imidazol-2-yl]heptanal |
| SMILES | CN.CNC(=O)CCc1nc2ccccc2s1.O=CCCCCCCc1ncc(-c2ccc(-n3cccn3)cc2)[nH]1 |
| InChI | InChI=1S/C19H22N4O.C11H12N2OS.CH5N/c24-14-5-3-1-2-4-7-19-20-15-18(22-19)16-8-10-17(11-9-16)23-13-6-12-21-23;1-12-10(14)6-7-11-13-8-4-2-3-5-9(8)15-11;1-2/h6,8-15H,1-5,7H2,(H,20,22);2-5H,6-7H2,1H3,(H,12,14);2H2,1H3 |
| InChIKey | WUJISVPUTCAAEG-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 131.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.77 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|