C19H24N4O — CID 130373888
7-[5-[4-(3,4-dihydropyrazol-2-yl)phenyl]-1H-imidazol-2-yl]heptanal (PubChem CID 130373888) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is 7-[5-[4-(3,4-dihydropyrazol-2-yl)phenyl]-1H-imidazol-2-yl]heptanal.
| Compound Name | 7-[5-[4-(3,4-dihydropyrazol-2-yl)phenyl]-1H-imidazol-2-yl]heptanal |
|---|---|
| PubChem CID | 130373888 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 7-[5-[4-(3,4-dihydropyrazol-2-yl)phenyl]-1H-imidazol-2-yl]heptanal |
| SMILES | O=CCCCCCCc1ncc(-c2ccc(N3CCC=N3)cc2)[nH]1 |
| InChI | InChI=1S/C19H24N4O/c24-14-5-3-1-2-4-7-19-20-15-18(22-19)16-8-10-17(11-9-16)23-13-6-12-21-23/h8-12,14-15H,1-7,13H2,(H,20,22) |
| InChIKey | ULQPTFKJKHMCOQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 61.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|