C21H28N2 — CID 130373680
2-heptyl-5-[4-[(1Z,3Z)-penta-1,3-dienyl]phenyl]-1H-imidazole (PubChem CID 130373680) has the molecular formula C21H28N2 and a molecular weight of 308.47 g/mol. Its IUPAC name is 2-heptyl-5-[4-[(1Z,3Z)-penta-1,3-dienyl]phenyl]-1H-imidazole.
| Compound Name | 2-heptyl-5-[4-[(1Z,3Z)-penta-1,3-dienyl]phenyl]-1H-imidazole |
|---|---|
| PubChem CID | 130373680 |
| Molecular Formula | C21H28N2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | 2-heptyl-5-[4-[(1Z,3Z)-penta-1,3-dienyl]phenyl]-1H-imidazole |
| SMILES | C/C=C\C=C/c1ccc(-c2cnc(CCCCCCC)[nH]2)cc1 |
| InChI | InChI=1S/C21H28N2/c1-3-5-7-8-10-12-21-22-17-20(23-21)19-15-13-18(14-16-19)11-9-6-4-2/h4,6,9,11,13-17H,3,5,7-8,10,12H2,1-2H3,(H,22,23)/b6-4-,11-9- |
| InChIKey | LXTQMROPVZXFLQ-MJCCWDFWSA-N |
| XLogP | 6.18 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|