C17H24N4 — CID 130373765
4-(2-heptyl-1H-imidazol-5-yl)-2-methanimidoylaniline (PubChem CID 130373765) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is 4-(2-heptyl-1H-imidazol-5-yl)-2-methanimidoylaniline.
| Compound Name | 4-(2-heptyl-1H-imidazol-5-yl)-2-methanimidoylaniline |
|---|---|
| PubChem CID | 130373765 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 4-(2-heptyl-1H-imidazol-5-yl)-2-methanimidoylaniline |
| SMILES | [H]/N=C/c1cc(-c2cnc(CCCCCCC)[nH]2)ccc1N |
| InChI | InChI=1S/C17H24N4/c1-2-3-4-5-6-7-17-20-12-16(21-17)13-8-9-15(19)14(10-13)11-18/h8-12,18H,2-7,19H2,1H3,(H,20,21)/b18-11+ |
| InChIKey | VTMVUDQTZQRBQI-WOJGMQOQSA-N |
| XLogP | 4.17 |
| TPSA | 78.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|