C14H17F2N3 — CID 43651162
5-[5-(3,4-difluorophenyl)-1H-imidazol-2-yl]pentan-1-amine (PubChem CID 43651162) has the molecular formula C14H17F2N3 and a molecular weight of 265.31 g/mol. Its IUPAC name is 5-[5-(3,4-difluorophenyl)-1H-imidazol-2-yl]pentan-1-amine.
| Compound Name | 5-[5-(3,4-difluorophenyl)-1H-imidazol-2-yl]pentan-1-amine |
|---|---|
| PubChem CID | 43651162 |
| Molecular Formula | C14H17F2N3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 5-[5-(3,4-difluorophenyl)-1H-imidazol-2-yl]pentan-1-amine |
| SMILES | NCCCCCc1ncc(-c2ccc(F)c(F)c2)[nH]1 |
| InChI | InChI=1S/C14H17F2N3/c15-11-6-5-10(8-12(11)16)13-9-18-14(19-13)4-2-1-3-7-17/h5-6,8-9H,1-4,7,17H2,(H,18,19) |
| InChIKey | OIXQOTPSIIPNQI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|