C14H17Cl2N3 — CID 43651166
5-[5-(2,4-dichlorophenyl)-1H-imidazol-2-yl]pentan-1-amine (PubChem CID 43651166) has the molecular formula C14H17Cl2N3 and a molecular weight of 298.22 g/mol. Its IUPAC name is 5-[5-(2,4-dichlorophenyl)-1H-imidazol-2-yl]pentan-1-amine.
| Compound Name | 5-[5-(2,4-dichlorophenyl)-1H-imidazol-2-yl]pentan-1-amine |
|---|---|
| PubChem CID | 43651166 |
| Molecular Formula | C14H17Cl2N3 |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 5-[5-(2,4-dichlorophenyl)-1H-imidazol-2-yl]pentan-1-amine |
| SMILES | NCCCCCc1ncc(-c2ccc(Cl)cc2Cl)[nH]1 |
| InChI | InChI=1S/C14H17Cl2N3/c15-10-5-6-11(12(16)8-10)13-9-18-14(19-13)4-2-1-3-7-17/h5-6,8-9H,1-4,7,17H2,(H,18,19) |
| InChIKey | FSTJANDAQBVDGP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|