C23H29NO3 — CID 11845448
tert-butyl (2R,4S)-4-(naphthalen-2-ylmethoxy)-2-prop-2-enylpyrrolidine-1-carboxylate (PubChem CID 11845448) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is tert-butyl (2R,4S)-4-(naphthalen-2-ylmethoxy)-2-prop-2-enylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4S)-4-(naphthalen-2-ylmethoxy)-2-prop-2-enylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11845448 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | tert-butyl (2R,4S)-4-(naphthalen-2-ylmethoxy)-2-prop-2-enylpyrrolidine-1-carboxylate |
| SMILES | C=CC[C@@H]1C[C@H](OCc2ccc3ccccc3c2)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H29NO3/c1-5-8-20-14-21(15-24(20)22(25)27-23(2,3)4)26-16-17-11-12-18-9-6-7-10-19(18)13-17/h5-7,9-13,20-21H,1,8,14-16H2,2-4H3/t20-,21+/m1/s1 |
| InChIKey | SCELIXYQXIWCFB-RTWAWAEBSA-N |
| XLogP | 5.31 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|