methyl 5-ethyl-6-methoxy-3,6-dihydro-2H-pyridine-1-carboxylate

C10H17NO3 — CID 11845726

IUPACmethyl 5-ethyl-6-methoxy-3,6-dihydro-2H-pyridine-1-carboxylate
SMILESCCC1=CCCN(C(=O)OC)C1OC
InChIInChI=1S/C10H17NO3/c1-4-8-6-5-7-11(9(8)13-2)10(12)14-3/h6,9H,4-5,7H2,1-3H3
InChIKeyYZPCDWQPGYNESQ-UHFFFAOYSA-N
MW199.25 g/mol
LogP1.77
Rot. Bonds2

About methyl 5-ethyl-6-methoxy-3,6-dihydro-2H-pyridine-1-carboxylate

methyl 5-ethyl-6-methoxy-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 11845726) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is methyl 5-ethyl-6-methoxy-3,6-dihydro-2H-pyridine-1-carboxylate.

Molecular Properties

Compound Namemethyl 5-ethyl-6-methoxy-3,6-dihydro-2H-pyridine-1-carboxylate
PubChem CID11845726
Molecular FormulaC10H17NO3
Molecular Weight199.25 g/mol
Exact Mass199.12
IUPAC Namemethyl 5-ethyl-6-methoxy-3,6-dihydro-2H-pyridine-1-carboxylate
SMILESCCC1=CCCN(C(=O)OC)C1OC
InChIInChI=1S/C10H17NO3/c1-4-8-6-5-7-11(9(8)13-2)10(12)14-3/h6,9H,4-5,7H2,1-3H3
InChIKeyYZPCDWQPGYNESQ-UHFFFAOYSA-N
XLogP1.77
TPSA38.77 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.25
LogP ≤ 51.77
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze methyl 5-ethyl-6-methoxy-3,6-dihydro-2H-pyridine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-ethyl-6-methoxy-3,6-dihydro-2H-pyridine-1-carboxylate?
The IUPAC name of methyl 5-ethyl-6-methoxy-3,6-dihydro-2H-pyridine-1-carboxylate (CID 11845726) is methyl 5-ethyl-6-methoxy-3,6-dihydro-2H-pyridine-1-carboxylate.
What is the SMILES notation for methyl 5-ethyl-6-methoxy-3,6-dihydro-2H-pyridine-1-carboxylate?
The canonical SMILES for methyl 5-ethyl-6-methoxy-3,6-dihydro-2H-pyridine-1-carboxylate is CCC1=CCCN(C(=O)OC)C1OC.
What is the InChIKey of methyl 5-ethyl-6-methoxy-3,6-dihydro-2H-pyridine-1-carboxylate?
The InChIKey is YZPCDWQPGYNESQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO3/c1-4-8-6-5-7-11(9(8)13-2)10(12)14-3/h6,9H,4-5,7H2,1-3H3.
What are the key properties of methyl 5-ethyl-6-methoxy-3,6-dihydro-2H-pyridine-1-carboxylate?
methyl 5-ethyl-6-methoxy-3,6-dihydro-2H-pyridine-1-carboxylate has a molecular weight of 199.25 g/mol, XLogP of 1.77, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-ethyl-6-methoxy-3,6-dihydro-2H-pyridine-1-carboxylate is sourced from PubChem (CID 11845726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).