C10H13NO — CID 118458013
(4Z)-5-(ethylideneamino)-3-methylidenehepta-4,6-dien-2-one (PubChem CID 118458013) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is (4Z)-5-(ethylideneamino)-3-methylidenehepta-4,6-dien-2-one.
| Compound Name | (4Z)-5-(ethylideneamino)-3-methylidenehepta-4,6-dien-2-one |
|---|---|
| PubChem CID | 118458013 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (4Z)-5-(ethylideneamino)-3-methylidenehepta-4,6-dien-2-one |
| SMILES | C=CC(=C/C(=C)C(C)=O)/N=C/C |
| InChI | InChI=1S/C10H13NO/c1-5-10(11-6-2)7-8(3)9(4)12/h5-7H,1,3H2,2,4H3/b10-7-,11-6+ |
| InChIKey | LWSFQGVFRQJEBD-IKVLVDHLSA-N |
| XLogP | 2.29 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|