C28H30N2 — CID 118458071
2-[(3S)-1-benzylpyrrolidin-3-yl]-2-phenyl-2-(3-propylphenyl)acetonitrile (PubChem CID 118458071) has the molecular formula C28H30N2 and a molecular weight of 394.56 g/mol. Its IUPAC name is 2-[(3S)-1-benzylpyrrolidin-3-yl]-2-phenyl-2-(3-propylphenyl)acetonitrile.
| Compound Name | 2-[(3S)-1-benzylpyrrolidin-3-yl]-2-phenyl-2-(3-propylphenyl)acetonitrile |
|---|---|
| PubChem CID | 118458071 |
| Molecular Formula | C28H30N2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 2-[(3S)-1-benzylpyrrolidin-3-yl]-2-phenyl-2-(3-propylphenyl)acetonitrile |
| SMILES | CCCc1cccc(C(C#N)(c2ccccc2)[C@@H]2CCN(Cc3ccccc3)C2)c1 |
| InChI | InChI=1S/C28H30N2/c1-2-10-23-13-9-16-26(19-23)28(22-29,25-14-7-4-8-15-25)27-17-18-30(21-27)20-24-11-5-3-6-12-24/h3-9,11-16,19,27H,2,10,17-18,20-21H2,1H3/t27-,28?/m1/s1 |
| InChIKey | BNJFJZMUPZLGGM-QXPUDEPPSA-N |
| XLogP | 5.97 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |