C20H14F2OS — CID 118458288
4,6-difluoro-3-methyl-7-(4-methylphenoxy)dibenzothiophene (PubChem CID 118458288) has the molecular formula C20H14F2OS and a molecular weight of 340.39 g/mol. Its IUPAC name is 4,6-difluoro-3-methyl-7-(4-methylphenoxy)dibenzothiophene.
| Compound Name | 4,6-difluoro-3-methyl-7-(4-methylphenoxy)dibenzothiophene |
|---|---|
| PubChem CID | 118458288 |
| Molecular Formula | C20H14F2OS |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 4,6-difluoro-3-methyl-7-(4-methylphenoxy)dibenzothiophene |
| SMILES | Cc1ccc(Oc2ccc3c(sc4c(F)c(C)ccc43)c2F)cc1 |
| InChI | InChI=1S/C20H14F2OS/c1-11-3-6-13(7-4-11)23-16-10-9-15-14-8-5-12(2)17(21)19(14)24-20(15)18(16)22/h3-10H,1-2H3 |
| InChIKey | XGYANPAFJDSQRY-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |