C13H26O — CID 118458375
[1-ethyl-3,3-di(propan-2-yl)cyclobutyl]methanol (PubChem CID 118458375) has the molecular formula C13H26O and a molecular weight of 198.35 g/mol. Its IUPAC name is [1-ethyl-3,3-di(propan-2-yl)cyclobutyl]methanol.
| Compound Name | [1-ethyl-3,3-di(propan-2-yl)cyclobutyl]methanol |
|---|---|
| PubChem CID | 118458375 |
| Molecular Formula | C13H26O |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.20 |
| IUPAC Name | [1-ethyl-3,3-di(propan-2-yl)cyclobutyl]methanol |
| SMILES | CCC1(CO)CC(C(C)C)(C(C)C)C1 |
| InChI | InChI=1S/C13H26O/c1-6-12(9-14)7-13(8-12,10(2)3)11(4)5/h10-11,14H,6-9H2,1-5H3 |
| InChIKey | LHYFERTXZVAMDH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |