C11H22O4 — CID 150381482
[5-ethyl-2-(2-methylpropoxy)-1,3-dioxan-5-yl]methanol (PubChem CID 150381482) has the molecular formula C11H22O4 and a molecular weight of 218.29 g/mol. Its IUPAC name is [5-ethyl-2-(2-methylpropoxy)-1,3-dioxan-5-yl]methanol.
| Compound Name | [5-ethyl-2-(2-methylpropoxy)-1,3-dioxan-5-yl]methanol |
|---|---|
| PubChem CID | 150381482 |
| Molecular Formula | C11H22O4 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | [5-ethyl-2-(2-methylpropoxy)-1,3-dioxan-5-yl]methanol |
| SMILES | CCC1(CO)COC(OCC(C)C)OC1 |
| InChI | InChI=1S/C11H22O4/c1-4-11(6-12)7-14-10(15-8-11)13-5-9(2)3/h9-10,12H,4-8H2,1-3H3 |
| InChIKey | GZVJGBXZCDEYFE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |