C14H30O3Sn — CID 59297314
(2,2-dibutyl-5-ethyl-1,3,2-dioxastanninan-5-yl)methanol (PubChem CID 59297314) has the molecular formula C14H30O3Sn and a molecular weight of 365.10 g/mol. Its IUPAC name is (2,2-dibutyl-5-ethyl-1,3,2-dioxastanninan-5-yl)methanol.
| Compound Name | (2,2-dibutyl-5-ethyl-1,3,2-dioxastanninan-5-yl)methanol |
|---|---|
| PubChem CID | 59297314 |
| Molecular Formula | C14H30O3Sn |
| Molecular Weight | 365.10 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (2,2-dibutyl-5-ethyl-1,3,2-dioxastanninan-5-yl)methanol |
| SMILES | CCCC[Sn]1(CCCC)OCC(CC)(CO)CO1 |
| InChI | InChI=1S/C6H12O3.2C4H9.Sn/c1-2-6(3-7,4-8)5-9;2*1-3-4-2;/h7H,2-5H2,1H3;2*1,3-4H2,2H3;/q-2;;;+2 |
| InChIKey | HEJPCCBVSXOYHD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.10 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |