C24H54O3Sn3 — CID 71360609
2,2,4,4,6,6-hexabutyl-1,3,5,2,4,6-trioxatristanninane (PubChem CID 71360609) has the molecular formula C24H54O3Sn3 and a molecular weight of 746.83 g/mol. Its IUPAC name is 2,2,4,4,6,6-hexabutyl-1,3,5,2,4,6-trioxatristanninane.
| Compound Name | 2,2,4,4,6,6-hexabutyl-1,3,5,2,4,6-trioxatristanninane |
|---|---|
| PubChem CID | 71360609 |
| Molecular Formula | C24H54O3Sn3 |
| Molecular Weight | 746.83 g/mol |
| Exact Mass | 750.11 |
| IUPAC Name | 2,2,4,4,6,6-hexabutyl-1,3,5,2,4,6-trioxatristanninane |
| SMILES | CCCC[Sn]1(CCCC)O[Sn](CCCC)(CCCC)O[Sn](CCCC)(CCCC)O1 |
| InChI | InChI=1S/6C4H9.3O.3Sn/c6*1-3-4-2;;;;;;/h6*1,3-4H2,2H3;;;;;; |
| InChIKey | CSYHBUCHKIUCDH-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.83 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |