C16H36O4Sn — CID 66811542
2,2-dibutyl-1,3,2-dioxastannolane;1,1-diethoxyethane (PubChem CID 66811542) has the molecular formula C16H36O4Sn and a molecular weight of 411.17 g/mol. Its IUPAC name is 2,2-dibutyl-1,3,2-dioxastannolane;1,1-diethoxyethane.
| Compound Name | 2,2-dibutyl-1,3,2-dioxastannolane;1,1-diethoxyethane |
|---|---|
| PubChem CID | 66811542 |
| Molecular Formula | C16H36O4Sn |
| Molecular Weight | 411.17 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 2,2-dibutyl-1,3,2-dioxastannolane;1,1-diethoxyethane |
| SMILES | CCCC[Sn]1(CCCC)OCCO1.CCOC(C)OCC |
| InChI | InChI=1S/C6H14O2.2C4H9.C2H4O2.Sn/c1-4-7-6(3)8-5-2;2*1-3-4-2;3-1-2-4;/h6H,4-5H2,1-3H3;2*1,3-4H2,2H3;1-2H2;/q;;;-2;+2 |
| InChIKey | OGMFCMYWOZUIQT-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.17 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|