C16H18F4O4Sn — CID 16707069
3,3-dibutyl-6,7,8,9-tetrafluoro-2,4,3-benzodioxastannepine-1,5-dione (PubChem CID 16707069) has the molecular formula C16H18F4O4Sn and a molecular weight of 469.02 g/mol. Its IUPAC name is 3,3-dibutyl-6,7,8,9-tetrafluoro-2,4,3-benzodioxastannepine-1,5-dione.
| Compound Name | 3,3-dibutyl-6,7,8,9-tetrafluoro-2,4,3-benzodioxastannepine-1,5-dione |
|---|---|
| PubChem CID | 16707069 |
| Molecular Formula | C16H18F4O4Sn |
| Molecular Weight | 469.02 g/mol |
| Exact Mass | 470.02 |
| IUPAC Name | 3,3-dibutyl-6,7,8,9-tetrafluoro-2,4,3-benzodioxastannepine-1,5-dione |
| SMILES | CCCC[Sn]1(CCCC)OC(=O)c2c(F)c(F)c(F)c(F)c2C(=O)O1 |
| InChI | InChI=1S/C8H2F4O4.2C4H9.Sn/c9-3-1(7(13)14)2(8(15)16)4(10)6(12)5(3)11;2*1-3-4-2;/h(H,13,14)(H,15,16);2*1,3-4H2,2H3;/q;;;+2/p-2 |
| InChIKey | RUZUYVXFJQOHAV-UHFFFAOYSA-L |
| XLogP | 4.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.02 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|