C12H26O3Sn — CID 16683329
3,3-dibutyl-5-ethyl-5-methyl-1,2,4,3-trioxastannolane (PubChem CID 16683329) has the molecular formula C12H26O3Sn and a molecular weight of 337.05 g/mol. Its IUPAC name is 3,3-dibutyl-5-ethyl-5-methyl-1,2,4,3-trioxastannolane.
| Compound Name | 3,3-dibutyl-5-ethyl-5-methyl-1,2,4,3-trioxastannolane |
|---|---|
| PubChem CID | 16683329 |
| Molecular Formula | C12H26O3Sn |
| Molecular Weight | 337.05 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 3,3-dibutyl-5-ethyl-5-methyl-1,2,4,3-trioxastannolane |
| SMILES | CCCC[Sn]1(CCCC)OOC(C)(CC)O1 |
| InChI | InChI=1S/C4H9O3.2C4H9.Sn/c1-3-4(2,5)7-6;2*1-3-4-2;/h6H,3H2,1-2H3;2*1,3-4H2,2H3;/q-1;;;+2/p-1 |
| InChIKey | IJWCBELDCCPUTA-UHFFFAOYSA-M |
| XLogP | 4.13 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.05 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|