C11H21O7P — CID 123259553
2-methoxypropyl 5-ethyl-5-(hydroxymethyl)-2-oxo-1,3,2λ5-dioxaphosphinane-2-carboxylate (PubChem CID 123259553) has the molecular formula C11H21O7P and a molecular weight of 296.26 g/mol. Its IUPAC name is 2-methoxypropyl 5-ethyl-5-(hydroxymethyl)-2-oxo-1,3,2λ5-dioxaphosphinane-2-carboxylate.
| Compound Name | 2-methoxypropyl 5-ethyl-5-(hydroxymethyl)-2-oxo-1,3,2λ5-dioxaphosphinane-2-carboxylate |
|---|---|
| PubChem CID | 123259553 |
| Molecular Formula | C11H21O7P |
| Molecular Weight | 296.26 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 2-methoxypropyl 5-ethyl-5-(hydroxymethyl)-2-oxo-1,3,2λ5-dioxaphosphinane-2-carboxylate |
| SMILES | CCC1(CO)COP(=O)(C(=O)OCC(C)OC)OC1 |
| InChI | InChI=1S/C11H21O7P/c1-4-11(6-12)7-17-19(14,18-8-11)10(13)16-5-9(2)15-3/h9,12H,4-8H2,1-3H3 |
| InChIKey | ZFQKFWOBFKKQIG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|