About 2-methoxypropyl 5-ethyl-5-(hydroxymethyl)-2-oxo-1,3,2λ5-dioxaphosphinane-2-carboxylate
2-methoxypropyl 5-ethyl-5-(hydroxymethyl)-2-oxo-1,3,2λ5-dioxaphosphinane-2-carboxylate (PubChem CID 123259553) has the molecular formula C11H21O7P
and a molecular weight of 296.26 g/mol. Its IUPAC name is 2-methoxypropyl 5-ethyl-5-(hydroxymethyl)-2-oxo-1,3,2λ5-dioxaphosphinane-2-carboxylate.
Molecular Properties
| Compound Name | 2-methoxypropyl 5-ethyl-5-(hydroxymethyl)-2-oxo-1,3,2λ5-dioxaphosphinane-2-carboxylate |
| PubChem CID | 123259553 |
| Molecular Formula | C11H21O7P |
| Molecular Weight | 296.26 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 2-methoxypropyl 5-ethyl-5-(hydroxymethyl)-2-oxo-1,3,2λ5-dioxaphosphinane-2-carboxylate |
| SMILES | CCC1(CO)COP(=O)(C(=O)OCC(C)OC)OC1 |
| InChI | InChI=1S/C11H21O7P/c1-4-11(6-12)7-17-19(14,18-8-11)10(13)16-5-9(2)15-3/h9,12H,4-8H2,1-3H3 |
| InChIKey | ZFQKFWOBFKKQIG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxypropyl 5-ethyl-5-(hydroxymethyl)-2-oxo-1,3,2λ5-dioxaphosphinane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxypropyl 5-ethyl-5-(hydroxymethyl)-2-oxo-1,3,2λ5-dioxaphosphinane-2-carboxylate?
The IUPAC name of 2-methoxypropyl 5-ethyl-5-(hydroxymethyl)-2-oxo-1,3,2λ5-dioxaphosphinane-2-carboxylate (CID 123259553) is 2-methoxypropyl 5-ethyl-5-(hydroxymethyl)-2-oxo-1,3,2λ5-dioxaphosphinane-2-carboxylate.
What is the SMILES notation for 2-methoxypropyl 5-ethyl-5-(hydroxymethyl)-2-oxo-1,3,2λ5-dioxaphosphinane-2-carboxylate?
The canonical SMILES for 2-methoxypropyl 5-ethyl-5-(hydroxymethyl)-2-oxo-1,3,2λ5-dioxaphosphinane-2-carboxylate is CCC1(CO)COP(=O)(C(=O)OCC(C)OC)OC1.
What is the InChIKey of 2-methoxypropyl 5-ethyl-5-(hydroxymethyl)-2-oxo-1,3,2λ5-dioxaphosphinane-2-carboxylate?
The InChIKey is ZFQKFWOBFKKQIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21O7P/c1-4-11(6-12)7-17-19(14,18-8-11)10(13)16-5-9(2)15-3/h9,12H,4-8H2,1-3H3.
What are the key properties of 2-methoxypropyl 5-ethyl-5-(hydroxymethyl)-2-oxo-1,3,2λ5-dioxaphosphinane-2-carboxylate?
2-methoxypropyl 5-ethyl-5-(hydroxymethyl)-2-oxo-1,3,2λ5-dioxaphosphinane-2-carboxylate has a molecular weight of 296.26 g/mol, XLogP of 1.79, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxypropyl 5-ethyl-5-(hydroxymethyl)-2-oxo-1,3,2λ5-dioxaphosphinane-2-carboxylate is sourced from PubChem (CID 123259553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).