C20H29NO4 — CID 118459164
(3Z)-3-[2-(2-bicyclo[2.2.1]heptanyl)-1-hydroxyethylidene]-1-heptanoylpyrrolidine-2,4-dione (PubChem CID 118459164) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is (3Z)-3-[2-(2-bicyclo[2.2.1]heptanyl)-1-hydroxyethylidene]-1-heptanoylpyrrolidine-2,4-dione.
| Compound Name | (3Z)-3-[2-(2-bicyclo[2.2.1]heptanyl)-1-hydroxyethylidene]-1-heptanoylpyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 118459164 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | (3Z)-3-[2-(2-bicyclo[2.2.1]heptanyl)-1-hydroxyethylidene]-1-heptanoylpyrrolidine-2,4-dione |
| SMILES | CCCCCCC(=O)N1CC(=O)/C(=C(/O)CC2CC3CCC2C3)C1=O |
| InChI | InChI=1S/C20H29NO4/c1-2-3-4-5-6-18(24)21-12-17(23)19(20(21)25)16(22)11-15-10-13-7-8-14(15)9-13/h13-15,22H,2-12H2,1H3/b19-16- |
| InChIKey | MPLQTXPEDYIXDK-MNDPQUGUSA-N |
| XLogP | 3.53 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|