C9H10FNO3S — CID 118463237
4-(3-fluorophenyl)-1,3,4-oxathiazinane 3,3-dioxide (PubChem CID 118463237) has the molecular formula C9H10FNO3S and a molecular weight of 231.25 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-1,3,4-oxathiazinane 3,3-dioxide.
| Compound Name | 4-(3-fluorophenyl)-1,3,4-oxathiazinane 3,3-dioxide |
|---|---|
| PubChem CID | 118463237 |
| Molecular Formula | C9H10FNO3S |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | 4-(3-fluorophenyl)-1,3,4-oxathiazinane 3,3-dioxide |
| SMILES | O=S1(=O)COCCN1c1cccc(F)c1 |
| InChI | InChI=1S/C9H10FNO3S/c10-8-2-1-3-9(6-8)11-4-5-14-7-15(11,12)13/h1-3,6H,4-5,7H2 |
| InChIKey | LFKPRADUZORLJK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |