C27H46O4Si — CID 11846765
methyl (1R,2R,4R,4aS,4bS,8aR,10aS)-4-[1-[tert-butyl(dimethyl)silyl]oxypropyl]-1,2-dimethyl-7-oxo-2,3,4,4a,4b,8,8a,9,10,10a-decahydrophenanthrene-1-carboxylate (PubChem CID 11846765) has the molecular formula C27H46O4Si and a molecular weight of 462.75 g/mol. Its IUPAC name is methyl (1R,2R,4R,4aS,4bS,8aR,10aS)-4-[1-[tert-butyl(dimethyl)silyl]oxypropyl]-1,2-dimethyl-7-oxo-2,3,4,4a,4b,8,8a,9,10,10a-decahydrophenanthrene-1-carboxylate.
| Compound Name | methyl (1R,2R,4R,4aS,4bS,8aR,10aS)-4-[1-[tert-butyl(dimethyl)silyl]oxypropyl]-1,2-dimethyl-7-oxo-2,3,4,4a,4b,8,8a,9,10,10a-decahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 11846765 |
| Molecular Formula | C27H46O4Si |
| Molecular Weight | 462.75 g/mol |
| Exact Mass | 462.32 |
| IUPAC Name | methyl (1R,2R,4R,4aS,4bS,8aR,10aS)-4-[1-[tert-butyl(dimethyl)silyl]oxypropyl]-1,2-dimethyl-7-oxo-2,3,4,4a,4b,8,8a,9,10,10a-decahydrophenanthrene-1-carboxylate |
| SMILES | CCC(O[Si](C)(C)C(C)(C)C)[C@@H]1C[C@@H](C)[C@@](C)(C(=O)OC)[C@H]2CC[C@@H]3CC(=O)C=C[C@H]3[C@H]12 |
| InChI | InChI=1S/C27H46O4Si/c1-10-23(31-32(8,9)26(3,4)5)21-15-17(2)27(6,25(29)30-7)22-14-11-18-16-19(28)12-13-20(18)24(21)22/h12-13,17-18,20-24H,10-11,14-16H2,1-9H3/t17-,18-,20-,21+,22+,23?,24-,27-/m1/s1 |
| InChIKey | BOZRIFIRIOPQRW-GISZFJAOSA-N |
| XLogP | 6.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.75 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|